C19H32O2 — CID 605575
methyl 4-(5-pentyl-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl)butanoate (PubChem CID 605575) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is methyl 4-(5-pentyl-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl)butanoate.
| Compound Name | methyl 4-(5-pentyl-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl)butanoate |
|---|---|
| PubChem CID | 605575 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | methyl 4-(5-pentyl-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl)butanoate |
| SMILES | CCCCCC1=CCC2CCCC2C1CCCC(=O)OC |
| InChI | InChI=1S/C19H32O2/c1-3-4-5-8-15-13-14-16-9-6-10-17(16)18(15)11-7-12-19(20)21-2/h13,16-18H,3-12,14H2,1-2H3 |
| InChIKey | QICYXSKJIVJXOJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|