C20H20N4O2 — CID 6055762
(E)-4-oxo-N-(4-phenyldiazenylphenyl)-4-pyrrolidin-1-ylbut-2-enamide (PubChem CID 6055762) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (E)-4-oxo-N-(4-phenyldiazenylphenyl)-4-pyrrolidin-1-ylbut-2-enamide.
| Compound Name | (E)-4-oxo-N-(4-phenyldiazenylphenyl)-4-pyrrolidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 6055762 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (E)-4-oxo-N-(4-phenyldiazenylphenyl)-4-pyrrolidin-1-ylbut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1CCCC1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c25-19(12-13-20(26)24-14-4-5-15-24)21-16-8-10-18(11-9-16)23-22-17-6-2-1-3-7-17/h1-3,6-13H,4-5,14-15H2,(H,21,25)/b13-12+,23-22+ |
| InChIKey | NSSNSDCHPYOYPG-JLOFEOLUSA-N |
| XLogP | 4.22 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|