C22H23BrN2O3 — CID 60557641
5-bromo-3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-1-benzofuran-2-carboxamide (PubChem CID 60557641) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 60557641 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-bromo-3-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cccc(CN3CCOCC3)c2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C22H23BrN2O3/c1-15-19-12-18(23)5-6-20(19)28-21(15)22(26)24-13-16-3-2-4-17(11-16)14-25-7-9-27-10-8-25/h2-6,11-12H,7-10,13-14H2,1H3,(H,24,26) |
| InChIKey | HJIFOUSCKMVCLQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |