C24H26N2O2 — CID 60558316
3-(3-methoxyphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 60558316) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(3-methoxyphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 60558316 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | COc1cccc(CCC(=O)N(CCc2ccccc2)Cc2cccnc2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-23-11-5-9-21(17-23)12-13-24(27)26(19-22-10-6-15-25-18-22)16-14-20-7-3-2-4-8-20/h2-11,15,17-18H,12-14,16,19H2,1H3 |
| InChIKey | ANGQTTKMRLDLIP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |