C21H23N3O — CID 60559194
(E)-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 60559194) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is (E)-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 60559194 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (E)-N-[2-methyl-3-(2-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1nccn1CC(C)CNC(=O)/C=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C21H23N3O/c1-16(15-24-13-12-22-17(24)2)14-23-21(25)11-10-19-8-5-7-18-6-3-4-9-20(18)19/h3-13,16H,14-15H2,1-2H3,(H,23,25)/b11-10+ |
| InChIKey | IVMLCYXBZVUMHQ-ZHACJKMWSA-N |
| XLogP | 3.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|