C18H24Cl2N2O2 — CID 60559245
2-(2,4-dichlorophenoxy)-1-(3-pyrrolidin-1-ylpiperidin-1-yl)propan-1-one (PubChem CID 60559245) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-(3-pyrrolidin-1-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-(3-pyrrolidin-1-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 60559245 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-(3-pyrrolidin-1-ylpiperidin-1-yl)propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-13(24-17-7-6-14(19)11-16(17)20)18(23)22-10-4-5-15(12-22)21-8-2-3-9-21/h6-7,11,13,15H,2-5,8-10,12H2,1H3 |
| InChIKey | JYKIGPAVHYKMFH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |