C12H14IN3O3 — CID 60559925
2-acetamido-N-[2-(4-iodoanilino)-2-oxoethyl]acetamide (PubChem CID 60559925) has the molecular formula C12H14IN3O3 and a molecular weight of 375.17 g/mol. Its IUPAC name is 2-acetamido-N-[2-(4-iodoanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-acetamido-N-[2-(4-iodoanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60559925 |
| Molecular Formula | C12H14IN3O3 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-acetamido-N-[2-(4-iodoanilino)-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)NCC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H14IN3O3/c1-8(17)14-6-11(18)15-7-12(19)16-10-4-2-9(13)3-5-10/h2-5H,6-7H2,1H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | VGFCMZXRDLYKMV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|