About 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole
2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole (PubChem CID 60560406) has the molecular formula C10H9F3N4OS2
and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole |
| PubChem CID | 60560406 |
| Molecular Formula | C10H9F3N4OS2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole |
| SMILES | CCOc1nnc(CSc2nccc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C10H9F3N4OS2/c1-2-18-9-17-16-7(20-9)5-19-8-14-4-3-6(15-8)10(11,12)13/h3-4H,2,5H2,1H3 |
| InChIKey | MSTOSYBMHYECIG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole?
The IUPAC name of 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole (CID 60560406) is 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole.
What is the SMILES notation for 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole?
The canonical SMILES for 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole is CCOc1nnc(CSc2nccc(C(F)(F)F)n2)s1.
What is the InChIKey of 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole?
The InChIKey is MSTOSYBMHYECIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N4OS2/c1-2-18-9-17-16-7(20-9)5-19-8-14-4-3-6(15-8)10(11,12)13/h3-4H,2,5H2,1H3.
What are the key properties of 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole?
2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole has a molecular weight of 322.34 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole is sourced from PubChem (CID 60560406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).