C27H32N2O6 — CID 6056060
(E)-[2-(1,3-benzodioxol-5-yl)-1-[2-(diethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-propan-2-yloxyphenyl)methanolate (PubChem CID 6056060) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is (E)-[2-(1,3-benzodioxol-5-yl)-1-[2-(diethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-propan-2-yloxyphenyl)methanolate.
| Compound Name | (E)-[2-(1,3-benzodioxol-5-yl)-1-[2-(diethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-propan-2-yloxyphenyl)methanolate |
|---|---|
| PubChem CID | 6056060 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (E)-[2-(1,3-benzodioxol-5-yl)-1-[2-(diethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-propan-2-yloxyphenyl)methanolate |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)/C(=C(/[O-])c2ccc(OC(C)C)cc2)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H32N2O6/c1-5-28(6-2)13-14-29-24(19-9-12-21-22(15-19)34-16-33-21)23(26(31)27(29)32)25(30)18-7-10-20(11-8-18)35-17(3)4/h7-12,15,17,24,30H,5-6,13-14,16H2,1-4H3/b25-23+ |
| InChIKey | QSMLECZSSCGQDI-WJTDDFOZSA-N |
| XLogP | 1.35 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|