C15H13Cl3N4O — CID 60560763
6-(cyclopropylamino)-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide (PubChem CID 60560763) has the molecular formula C15H13Cl3N4O and a molecular weight of 371.66 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide.
| Compound Name | 6-(cyclopropylamino)-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 60560763 |
| Molecular Formula | C15H13Cl3N4O |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 6-(cyclopropylamino)-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1c(Cl)cc(Cl)cc1Cl)c1ccc(NC2CC2)nc1 |
| InChI | InChI=1S/C15H13Cl3N4O/c16-9-5-11(17)14(12(18)6-9)21-22-15(23)8-1-4-13(19-7-8)20-10-2-3-10/h1,4-7,10,21H,2-3H2,(H,19,20)(H,22,23) |
| InChIKey | ZTDHAQUGKPWPJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|