C16H11ClF3N5O3 — CID 60561507
1-[4-chloro-2-(trifluoromethyl)phenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]tetrazole (PubChem CID 60561507) has the molecular formula C16H11ClF3N5O3 and a molecular weight of 413.74 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]tetrazole.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]tetrazole |
|---|---|
| PubChem CID | 60561507 |
| Molecular Formula | C16H11ClF3N5O3 |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]tetrazole |
| SMILES | Cc1cc(OCc2nnnn2-c2ccc(Cl)cc2C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3N5O3/c1-9-6-11(3-5-13(9)25(26)27)28-8-15-21-22-23-24(15)14-4-2-10(17)7-12(14)16(18,19)20/h2-7H,8H2,1H3 |
| InChIKey | XPBRMDFCSYFTNJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|