About but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate
but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate (PubChem CID 60562596) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate |
| PubChem CID | 60562596 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate |
| SMILES | C#CCCOC(=O)/C=C/c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H11NO2/c1-2-3-9-17-14(16)8-7-12-5-4-6-13(10-12)11-15/h1,4-8,10H,3,9H2/b8-7+ |
| InChIKey | GDRUSUMCRMDPFN-BQYQJAHWSA-N |
| XLogP | 2.14 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate?
The IUPAC name of but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate (CID 60562596) is but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate.
What is the SMILES notation for but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate?
The canonical SMILES for but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate is C#CCCOC(=O)/C=C/c1cccc(C#N)c1.
What is the InChIKey of but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate?
The InChIKey is GDRUSUMCRMDPFN-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H11NO2/c1-2-3-9-17-14(16)8-7-12-5-4-6-13(10-12)11-15/h1,4-8,10H,3,9H2/b8-7+.
What are the key properties of but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate?
but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate has a molecular weight of 225.25 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl (E)-3-(3-cyanophenyl)prop-2-enoate is sourced from PubChem (CID 60562596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).