C20H23N3O2S — CID 60563304
N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-prop-2-ynylpiperidine-4-carboxamide (PubChem CID 60563304) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-prop-2-ynylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-prop-2-ynylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60563304 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-prop-2-ynylpiperidine-4-carboxamide |
| SMILES | C#CCN1CCC(C(=O)Nc2nc(-c3ccc(OC)cc3)c(C)s2)CC1 |
| InChI | InChI=1S/C20H23N3O2S/c1-4-11-23-12-9-16(10-13-23)19(24)22-20-21-18(14(2)26-20)15-5-7-17(25-3)8-6-15/h1,5-8,16H,9-13H2,2-3H3,(H,21,22,24) |
| InChIKey | CZHGLTKUALSRET-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|