C17H23N5OS — CID 60564225
N-(3-methyl-1-phenylbutyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 60564225) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 60564225 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)NC(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H23N5OS/c1-4-10-22-17(19-20-21-22)24-12-16(23)18-15(11-13(2)3)14-8-6-5-7-9-14/h4-9,13,15H,1,10-12H2,2-3H3,(H,18,23) |
| InChIKey | XVHVIRSPXREDAH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|