C13H17FN2O3 — CID 60565397
methyl 2-[(2-fluoropyridine-4-carbonyl)amino]-4-methylpentanoate (PubChem CID 60565397) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 2-[(2-fluoropyridine-4-carbonyl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(2-fluoropyridine-4-carbonyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 60565397 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 2-[(2-fluoropyridine-4-carbonyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C13H17FN2O3/c1-8(2)6-10(13(18)19-3)16-12(17)9-4-5-15-11(14)7-9/h4-5,7-8,10H,6H2,1-3H3,(H,16,17) |
| InChIKey | RWYGKFOOAGFOIK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|