C18H18BrNO2 — CID 60565625
(E)-3-(2-bromophenyl)-N-[(2-ethoxyphenyl)methyl]prop-2-enamide (PubChem CID 60565625) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-[(2-ethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-[(2-ethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 60565625 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-[(2-ethoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1ccccc1CNC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C18H18BrNO2/c1-2-22-17-10-6-4-8-15(17)13-20-18(21)12-11-14-7-3-5-9-16(14)19/h3-12H,2,13H2,1H3,(H,20,21)/b12-11+ |
| InChIKey | BDNVQCICAASFAF-VAWYXSNFSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|