About 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile
6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile (PubChem CID 60567965) has the molecular formula C18H17F2N3O3
and a molecular weight of 361.35 g/mol. Its IUPAC name is 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile |
| PubChem CID | 60567965 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(OC(F)F)cc2c1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H17F2N3O3/c19-17(20)26-13-1-2-15-14(9-13)16(12(10-21)11-22-15)23-5-3-18(4-6-23)24-7-8-25-18/h1-2,9,11,17H,3-8H2 |
| InChIKey | PNGZPEUWHJIKRY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile?
The IUPAC name of 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile (CID 60567965) is 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile.
What is the SMILES notation for 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile?
The canonical SMILES for 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile is N#Cc1cnc2ccc(OC(F)F)cc2c1N1CCC2(CC1)OCCO2.
What is the InChIKey of 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile?
The InChIKey is PNGZPEUWHJIKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2N3O3/c19-17(20)26-13-1-2-15-14(9-13)16(12(10-21)11-22-15)23-5-3-18(4-6-23)24-7-8-25-18/h1-2,9,11,17H,3-8H2.
What are the key properties of 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile?
6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile has a molecular weight of 361.35 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethoxy)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)quinoline-3-carbonitrile is sourced from PubChem (CID 60567965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).