C24H26N4OS — CID 60568705
6-methyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 60568705) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 6-methyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 6-methyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 60568705 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 6-methyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cc1nc2c(cnn2C(C)C)cc1C(=O)NCCSCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H26N4OS/c1-16(2)28-23-20(14-26-28)13-22(17(3)27-23)24(29)25-11-12-30-15-19-9-6-8-18-7-4-5-10-21(18)19/h4-10,13-14,16H,11-12,15H2,1-3H3,(H,25,29) |
| InChIKey | SBXUMHVLMWZVCX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|