C14H17ClFN3O2 — CID 60570447
1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 60570447) has the molecular formula C14H17ClFN3O2 and a molecular weight of 313.76 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60570447 |
| Molecular Formula | C14H17ClFN3O2 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H17ClFN3O2/c1-17-14(21)12-3-2-6-19(12)8-13(20)18-11-7-9(15)4-5-10(11)16/h4-5,7,12H,2-3,6,8H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | USAOUZCSFMNJMX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |