C32H40N6O — CID 6057046
6-N-[(Z)-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 6057046) has the molecular formula C32H40N6O and a molecular weight of 524.71 g/mol. Its IUPAC name is 6-N-[(Z)-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[(Z)-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 6057046 |
| Molecular Formula | C32H40N6O |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 6-N-[(Z)-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CC(C)c1nc(N/N=C\c2cn(CCOc3ccc(C4CCCCC4)cc3)c3ccccc23)cc(N(C)C)n1 |
| InChI | InChI=1S/C32H40N6O/c1-23(2)32-34-30(20-31(35-32)37(3)4)36-33-21-26-22-38(29-13-9-8-12-28(26)29)18-19-39-27-16-14-25(15-17-27)24-10-6-5-7-11-24/h8-9,12-17,20-24H,5-7,10-11,18-19H2,1-4H3,(H,34,35,36)/b33-21- |
| InChIKey | XRTVLYHTVHKYEZ-HWIUFGAZSA-N |
| XLogP | 7.19 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|