C20H24FN3O2 — CID 60571271
3-acetamido-N-[2-(N-ethyl-2-methylanilino)ethyl]-4-fluorobenzamide (PubChem CID 60571271) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-acetamido-N-[2-(N-ethyl-2-methylanilino)ethyl]-4-fluorobenzamide.
| Compound Name | 3-acetamido-N-[2-(N-ethyl-2-methylanilino)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 60571271 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-acetamido-N-[2-(N-ethyl-2-methylanilino)ethyl]-4-fluorobenzamide |
| SMILES | CCN(CCNC(=O)c1ccc(F)c(NC(C)=O)c1)c1ccccc1C |
| InChI | InChI=1S/C20H24FN3O2/c1-4-24(19-8-6-5-7-14(19)2)12-11-22-20(26)16-9-10-17(21)18(13-16)23-15(3)25/h5-10,13H,4,11-12H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | QMQZFLYHKMAFGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |