C17H15ClN2O2S — CID 60572586
3-[(3-chlorophenyl)methoxy]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 60572586) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methoxy]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(3-chlorophenyl)methoxy]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 60572586 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-[(3-chlorophenyl)methoxy]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1cccc(OCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H15ClN2O2S/c18-14-5-1-3-12(9-14)11-22-15-6-2-4-13(10-15)16(21)20-17-19-7-8-23-17/h1-6,9-10H,7-8,11H2,(H,19,20,21) |
| InChIKey | FVQLCSKUQNONAC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |