C14H23BO2 — CID 605730
2-ethylspiro[5,6,7,8-tetrahydro-1,3,2-benzodioxaborinine-4,1'-cyclohexane] (PubChem CID 605730) has the molecular formula C14H23BO2 and a molecular weight of 234.15 g/mol. Its IUPAC name is 2-ethylspiro[5,6,7,8-tetrahydro-1,3,2-benzodioxaborinine-4,1'-cyclohexane].
| Compound Name | 2-ethylspiro[5,6,7,8-tetrahydro-1,3,2-benzodioxaborinine-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 605730 |
| Molecular Formula | C14H23BO2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-ethylspiro[5,6,7,8-tetrahydro-1,3,2-benzodioxaborinine-4,1'-cyclohexane] |
| SMILES | CCB1OC2=C(CCCC2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C14H23BO2/c1-2-15-16-13-9-5-4-8-12(13)14(17-15)10-6-3-7-11-14/h2-11H2,1H3 |
| InChIKey | WJDSJDRIPBIFHQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|