About 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide
2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide (PubChem CID 60573604) has the molecular formula C17H23Cl2FN2O
and a molecular weight of 361.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide.
Molecular Properties
| Compound Name | 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide |
| PubChem CID | 60573604 |
| Molecular Formula | C17H23Cl2FN2O |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide |
| SMILES | CC1CC(C)CN(CC(C)NC(=O)c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H23Cl2FN2O/c1-10-4-11(2)8-22(7-10)9-12(3)21-17(23)13-5-16(20)15(19)6-14(13)18/h5-6,10-12H,4,7-9H2,1-3H3,(H,21,23) |
| InChIKey | LBBYCOGMXJHOMG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide?
The IUPAC name of 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide (CID 60573604) is 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide.
What is the SMILES notation for 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide?
The canonical SMILES for 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide is CC1CC(C)CN(CC(C)NC(=O)c2cc(F)c(Cl)cc2Cl)C1.
What is the InChIKey of 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide?
The InChIKey is LBBYCOGMXJHOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23Cl2FN2O/c1-10-4-11(2)8-22(7-10)9-12(3)21-17(23)13-5-16(20)15(19)6-14(13)18/h5-6,10-12H,4,7-9H2,1-3H3,(H,21,23).
What are the key properties of 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide?
2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide has a molecular weight of 361.29 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]-5-fluorobenzamide is sourced from PubChem (CID 60573604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).