C22H31ClN2O2 — CID 60573636
N-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 60573636) has the molecular formula C22H31ClN2O2 and a molecular weight of 390.96 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60573636 |
| Molecular Formula | C22H31ClN2O2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclopentyl]methyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)NCC2(c3ccc(Cl)cc3)CCCC2)CC1 |
| InChI | InChI=1S/C22H31ClN2O2/c1-16(2)21(27)25-13-9-17(10-14-25)20(26)24-15-22(11-3-4-12-22)18-5-7-19(23)8-6-18/h5-8,16-17H,3-4,9-15H2,1-2H3,(H,24,26) |
| InChIKey | ISDOLADEMADDQP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |