C16H20N4O3 — CID 60573937
N-benzyl-3-(4-nitropyrazol-1-yl)-N-propan-2-ylpropanamide (PubChem CID 60573937) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-benzyl-3-(4-nitropyrazol-1-yl)-N-propan-2-ylpropanamide.
| Compound Name | N-benzyl-3-(4-nitropyrazol-1-yl)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 60573937 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-benzyl-3-(4-nitropyrazol-1-yl)-N-propan-2-ylpropanamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)CCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H20N4O3/c1-13(2)19(11-14-6-4-3-5-7-14)16(21)8-9-18-12-15(10-17-18)20(22)23/h3-7,10,12-13H,8-9,11H2,1-2H3 |
| InChIKey | OPMLXZZPPVIONV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|