C17H17BrFNO4S — CID 60573938
2-[(3-bromophenyl)methylsulfonyl]-N-[(3-fluoro-4-methoxyphenyl)methyl]acetamide (PubChem CID 60573938) has the molecular formula C17H17BrFNO4S and a molecular weight of 430.30 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfonyl]-N-[(3-fluoro-4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfonyl]-N-[(3-fluoro-4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 60573938 |
| Molecular Formula | C17H17BrFNO4S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfonyl]-N-[(3-fluoro-4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CS(=O)(=O)Cc2cccc(Br)c2)cc1F |
| InChI | InChI=1S/C17H17BrFNO4S/c1-24-16-6-5-12(8-15(16)19)9-20-17(21)11-25(22,23)10-13-3-2-4-14(18)7-13/h2-8H,9-11H2,1H3,(H,20,21) |
| InChIKey | UXZRFYBOUWRARM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |