About 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide
3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide (PubChem CID 60574444) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide |
| PubChem CID | 60574444 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1CC(C)CN(CC(C)NC(=O)c2nccnc2N)C1 |
| InChI | InChI=1S/C15H25N5O/c1-10-6-11(2)8-20(7-10)9-12(3)19-15(21)13-14(16)18-5-4-17-13/h4-5,10-12H,6-9H2,1-3H3,(H2,16,18)(H,19,21) |
| InChIKey | PEYPOSPRVNHJTQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide?
The IUPAC name of 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide (CID 60574444) is 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide.
What is the SMILES notation for 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide?
The canonical SMILES for 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide is CC1CC(C)CN(CC(C)NC(=O)c2nccnc2N)C1.
What is the InChIKey of 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide?
The InChIKey is PEYPOSPRVNHJTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O/c1-10-6-11(2)8-20(7-10)9-12(3)19-15(21)13-14(16)18-5-4-17-13/h4-5,10-12H,6-9H2,1-3H3,(H2,16,18)(H,19,21).
What are the key properties of 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide?
3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide has a molecular weight of 291.40 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[1-(3,5-dimethylpiperidin-1-yl)propan-2-yl]pyrazine-2-carboxamide is sourced from PubChem (CID 60574444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).