C17H16Cl2N2O2 — CID 60574786
2-chloro-N-(3-chloro-4-cyclopentyloxyphenyl)pyridine-4-carboxamide (PubChem CID 60574786) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-4-cyclopentyloxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(3-chloro-4-cyclopentyloxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60574786 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-chloro-N-(3-chloro-4-cyclopentyloxyphenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)c(Cl)c1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-14-10-12(5-6-15(14)23-13-3-1-2-4-13)21-17(22)11-7-8-20-16(19)9-11/h5-10,13H,1-4H2,(H,21,22) |
| InChIKey | JAKBYWMSCTUVSB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|