C24H28N4OS — CID 60575500
2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 60575500) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 60575500 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | CCCN(C(=O)Cn1c(-c2cccc(C)c2)n[nH]c1=S)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H28N4OS/c1-3-13-27(21-12-11-18-8-4-5-9-19(18)15-21)22(29)16-28-23(25-26-24(28)30)20-10-6-7-17(2)14-20/h4-10,14,21H,3,11-13,15-16H2,1-2H3,(H,26,30) |
| InChIKey | XKFMLOSCRSJQMT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|