C20H23NOS — CID 60575625
(E)-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thiophen-3-ylprop-2-enamide (PubChem CID 60575625) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is (E)-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 60575625 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (E)-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thiophen-3-ylprop-2-enamide |
| SMILES | CCCN(C(=O)/C=C/c1ccsc1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H23NOS/c1-2-12-21(20(22)10-7-16-11-13-23-15-16)19-9-8-17-5-3-4-6-18(17)14-19/h3-7,10-11,13,15,19H,2,8-9,12,14H2,1H3/b10-7+ |
| InChIKey | SGDWBRFYUKNRAV-JXMROGBWSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|