About N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide
N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide (PubChem CID 60576249) has the molecular formula C19H14FN3O3
and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide |
| PubChem CID | 60576249 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1cc(N2CCOC2=O)ccc1F)c1ccnc2ccccc12 |
| InChI | InChI=1S/C19H14FN3O3/c20-15-6-5-12(23-9-10-26-19(23)25)11-17(15)22-18(24)14-7-8-21-16-4-2-1-3-13(14)16/h1-8,11H,9-10H2,(H,22,24) |
| InChIKey | YVVZJQQBLHFBAJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide?
The IUPAC name of N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide (CID 60576249) is N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide.
What is the SMILES notation for N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide?
The canonical SMILES for N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide is O=C(Nc1cc(N2CCOC2=O)ccc1F)c1ccnc2ccccc12.
What is the InChIKey of N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide?
The InChIKey is YVVZJQQBLHFBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3O3/c20-15-6-5-12(23-9-10-26-19(23)25)11-17(15)22-18(24)14-7-8-21-16-4-2-1-3-13(14)16/h1-8,11H,9-10H2,(H,22,24).
What are the key properties of N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide?
N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide has a molecular weight of 351.34 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]quinoline-4-carboxamide is sourced from PubChem (CID 60576249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).