About 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea
1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea (PubChem CID 60577386) has the molecular formula C18H19FN2O
and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea.
Molecular Properties
| Compound Name | 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea |
| PubChem CID | 60577386 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)NC2CCc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C18H19FN2O/c1-12-2-4-13(5-3-12)11-20-18(22)21-17-9-6-14-10-15(19)7-8-16(14)17/h2-5,7-8,10,17H,6,9,11H2,1H3,(H2,20,21,22) |
| InChIKey | GZLKPYDIVJIQAO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea?
The IUPAC name of 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea (CID 60577386) is 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea.
What is the SMILES notation for 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea?
The canonical SMILES for 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea is Cc1ccc(CNC(=O)NC2CCc3cc(F)ccc32)cc1.
What is the InChIKey of 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea?
The InChIKey is GZLKPYDIVJIQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O/c1-12-2-4-13(5-3-12)11-20-18(22)21-17-9-6-14-10-15(19)7-8-16(14)17/h2-5,7-8,10,17H,6,9,11H2,1H3,(H2,20,21,22).
What are the key properties of 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea?
1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea has a molecular weight of 298.36 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-[(4-methylphenyl)methyl]urea is sourced from PubChem (CID 60577386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).