C18H19F3N2O4 — CID 60577749
1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 60577749) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 60577749 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C18H19F3N2O4/c19-18(20,21)27-16-8-2-1-7-15(16)22-17(24)23(11-13-5-3-9-25-13)12-14-6-4-10-26-14/h1-3,5,7-9,14H,4,6,10-12H2,(H,22,24) |
| InChIKey | QMWMWMLHZXGMAW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |