C20H15F2N3O5S — CID 60578603
ethyl 3-[[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate (PubChem CID 60578603) has the molecular formula C20H15F2N3O5S and a molecular weight of 447.42 g/mol. Its IUPAC name is ethyl 3-[[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 60578603 |
| Molecular Formula | C20H15F2N3O5S |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | ethyl 3-[[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ncc(Cc3ccc(F)cc3F)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15F2N3O5S/c1-2-30-19(27)13-5-12(6-15(7-13)25(28)29)18(26)24-20-23-10-16(31-20)8-11-3-4-14(21)9-17(11)22/h3-7,9-10H,2,8H2,1H3,(H,23,24,26) |
| InChIKey | VYCPLTRXBSVANR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|