About 3-methyl-3,5-diphenylpyrazole
3-methyl-3,5-diphenylpyrazole (PubChem CID 605788) has the molecular formula C16H14N2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-methyl-3,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 3-methyl-3,5-diphenylpyrazole |
| PubChem CID | 605788 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-methyl-3,5-diphenylpyrazole |
| SMILES | CC1(c2ccccc2)C=C(c2ccccc2)N=N1 |
| InChI | InChI=1S/C16H14N2/c1-16(14-10-6-3-7-11-14)12-15(17-18-16)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | BIJSHZAXMRASAK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,5-diphenylpyrazole?
The IUPAC name of 3-methyl-3,5-diphenylpyrazole (CID 605788) is 3-methyl-3,5-diphenylpyrazole.
What is the SMILES notation for 3-methyl-3,5-diphenylpyrazole?
The canonical SMILES for 3-methyl-3,5-diphenylpyrazole is CC1(c2ccccc2)C=C(c2ccccc2)N=N1.
What is the InChIKey of 3-methyl-3,5-diphenylpyrazole?
The InChIKey is BIJSHZAXMRASAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2/c1-16(14-10-6-3-7-11-14)12-15(17-18-16)13-8-4-2-5-9-13/h2-12H,1H3.
What are the key properties of 3-methyl-3,5-diphenylpyrazole?
3-methyl-3,5-diphenylpyrazole has a molecular weight of 234.30 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,5-diphenylpyrazole is sourced from PubChem (CID 605788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).