About 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one
5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one (PubChem CID 6057979) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one |
| PubChem CID | 6057979 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one |
| SMILES | CN1CC(C)(O)C(=O)CC1/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-15(18)11-16(2)13(10-14(15)17)9-8-12-6-4-3-5-7-12/h3-9,13,18H,10-11H2,1-2H3/b9-8+ |
| InChIKey | DHFSZVAQOILKKU-CMDGGOBGSA-N |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one?
The IUPAC name of 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one (CID 6057979) is 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one.
What is the SMILES notation for 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one?
The canonical SMILES for 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one is CN1CC(C)(O)C(=O)CC1/C=C/c1ccccc1.
What is the InChIKey of 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one?
The InChIKey is DHFSZVAQOILKKU-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H19NO2/c1-15(18)11-16(2)13(10-14(15)17)9-8-12-6-4-3-5-7-12/h3-9,13,18H,10-11H2,1-2H3/b9-8+.
What are the key properties of 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one?
5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one has a molecular weight of 245.32 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,5-dimethyl-2-[(E)-2-phenylethenyl]piperidin-4-one is sourced from PubChem (CID 6057979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).