C13H16F3N3O — CID 60580963
2-(dimethylamino)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide (PubChem CID 60580963) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-(dimethylamino)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide.
| Compound Name | 2-(dimethylamino)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60580963 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(dimethylamino)-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
| SMILES | C=CCN(CC(F)(F)F)C(=O)c1ccnc(N(C)C)c1 |
| InChI | InChI=1S/C13H16F3N3O/c1-4-7-19(9-13(14,15)16)12(20)10-5-6-17-11(8-10)18(2)3/h4-6,8H,1,7,9H2,2-3H3 |
| InChIKey | MOJKLOKYIVEPAG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|