C24H23F2N3O3S — CID 60581078
N-[(3-fluorophenyl)methyl]-N-[1-(4-fluorophenyl)propyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 60581078) has the molecular formula C24H23F2N3O3S and a molecular weight of 471.53 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-[1-(4-fluorophenyl)propyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-[1-(4-fluorophenyl)propyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 60581078 |
| Molecular Formula | C24H23F2N3O3S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-[1-(4-fluorophenyl)propyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CCC(c1ccc(F)cc1)N(Cc1cccc(F)c1)C(=O)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C24H23F2N3O3S/c1-2-22(18-6-9-20(25)10-7-18)29(15-17-4-3-5-21(26)14-17)24(30)19-8-11-23-27-33(31,32)13-12-28(23)16-19/h3-11,14,16,22H,2,12-13,15H2,1H3 |
| InChIKey | OCQGAPDSJNDRDN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |