About (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate
(2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate (PubChem CID 60581793) has the molecular formula C23H19BrN2O3
and a molecular weight of 451.32 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate.
Molecular Properties
| Compound Name | (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate |
| PubChem CID | 60581793 |
| Molecular Formula | C23H19BrN2O3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)Oc2cccnc2Br)cc1 |
| InChI | InChI=1S/C23H19BrN2O3/c1-28-16-10-8-15(9-11-16)22-18(17-5-2-3-6-19(17)26-22)12-13-21(27)29-20-7-4-14-25-23(20)24/h2-11,14,26H,12-13H2,1H3 |
| InChIKey | BBTDVKGZBHLHTB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate?
The IUPAC name of (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate (CID 60581793) is (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate.
What is the SMILES notation for (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate?
The canonical SMILES for (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate is COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)Oc2cccnc2Br)cc1.
What is the InChIKey of (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate?
The InChIKey is BBTDVKGZBHLHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19BrN2O3/c1-28-16-10-8-15(9-11-16)22-18(17-5-2-3-6-19(17)26-22)12-13-21(27)29-20-7-4-14-25-23(20)24/h2-11,14,26H,12-13H2,1H3.
What are the key properties of (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate?
(2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate has a molecular weight of 451.32 g/mol, XLogP of 5.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3-pyridinyl) 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanoate is sourced from PubChem (CID 60581793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).