About (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate
(4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate (PubChem CID 60582378) has the molecular formula C16H26F3NO4
and a molecular weight of 353.38 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate |
| PubChem CID | 60582378 |
| Molecular Formula | C16H26F3NO4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)C1CCC(OC(=O)CCNC(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H26F3NO4/c1-15(2,3)11-4-6-12(7-5-11)24-13(21)8-9-20-14(22)23-10-16(17,18)19/h11-12H,4-10H2,1-3H3,(H,20,22) |
| InChIKey | ZTYBSEGOCLPTSV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate?
The IUPAC name of (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate (CID 60582378) is (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate.
What is the SMILES notation for (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate?
The canonical SMILES for (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate is CC(C)(C)C1CCC(OC(=O)CCNC(=O)OCC(F)(F)F)CC1.
What is the InChIKey of (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate?
The InChIKey is ZTYBSEGOCLPTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F3NO4/c1-15(2,3)11-4-6-12(7-5-11)24-13(21)8-9-20-14(22)23-10-16(17,18)19/h11-12H,4-10H2,1-3H3,(H,20,22).
What are the key properties of (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate?
(4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate has a molecular weight of 353.38 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexyl) 3-(2,2,2-trifluoroethoxycarbonylamino)propanoate is sourced from PubChem (CID 60582378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).