C26H24N4O6 — CID 6058343
(E)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-prop-2-enoxyphenyl)methanolate (PubChem CID 6058343) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is (E)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-prop-2-enoxyphenyl)methanolate.
| Compound Name | (E)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-prop-2-enoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6058343 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (E)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-prop-2-enoxyphenyl)methanolate |
| SMILES | C=CCOc1ccc(/C([O-])=C2\C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H24N4O6/c1-2-15-36-21-9-7-18(8-10-21)24(31)22-23(19-5-3-6-20(16-19)30(34)35)29(26(33)25(22)32)13-4-12-28-14-11-27-17-28/h2-3,5-11,14,16-17,23H,1,4,12-13,15H2,(H,31,32) |
| InChIKey | HOYSTBQKQPAUDJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|