About 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea
1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea (PubChem CID 60583638) has the molecular formula C15H24N4O2S
and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
| PubChem CID | 60583638 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
| SMILES | Cc1ncc(CNC(=O)NCCCN2CCCCCC2=O)s1 |
| InChI | InChI=1S/C15H24N4O2S/c1-12-17-10-13(22-12)11-18-15(21)16-7-5-9-19-8-4-2-3-6-14(19)20/h10H,2-9,11H2,1H3,(H2,16,18,21) |
| InChIKey | DDGUEDWLTUVHQK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea?
The IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea (CID 60583638) is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea.
What is the SMILES notation for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea?
The canonical SMILES for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea is Cc1ncc(CNC(=O)NCCCN2CCCCCC2=O)s1.
What is the InChIKey of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea?
The InChIKey is DDGUEDWLTUVHQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2S/c1-12-17-10-13(22-12)11-18-15(21)16-7-5-9-19-8-4-2-3-6-14(19)20/h10H,2-9,11H2,1H3,(H2,16,18,21).
What are the key properties of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea?
1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea has a molecular weight of 324.45 g/mol, XLogP of 2.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea is sourced from PubChem (CID 60583638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).