C23H30N2O4S — CID 60584916
N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-5-(2,5-dimethylphenoxy)pentanamide (PubChem CID 60584916) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-5-(2,5-dimethylphenoxy)pentanamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-5-(2,5-dimethylphenoxy)pentanamide |
|---|---|
| PubChem CID | 60584916 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-5-(2,5-dimethylphenoxy)pentanamide |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)NCCS(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-18-10-11-19(2)22(17-18)29-15-6-5-9-23(26)24-13-16-30(27,28)25-14-12-20-7-3-4-8-21(20)25/h3-4,7-8,10-11,17H,5-6,9,12-16H2,1-2H3,(H,24,26) |
| InChIKey | VPGFUAJBMXVDCY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|