C15H8ClN3O2S — CID 60585789
(4Z)-4-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 60585789) has the molecular formula C15H8ClN3O2S and a molecular weight of 329.77 g/mol. Its IUPAC name is (4Z)-4-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 60585789 |
| Molecular Formula | C15H8ClN3O2S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | (4Z)-4-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C\c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C15H8ClN3O2S/c16-12-11(19-6-7-22-15(19)18-12)8-10-14(20)21-13(17-10)9-4-2-1-3-5-9/h1-8H/b10-8- |
| InChIKey | WDQPDHYBUVVTQB-NTMALXAHSA-N |
| XLogP | 3.39 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|