C17H14F3N3O5S — CID 60586226
2-[[2-[4-nitro-2-(trifluoromethyl)phenoxy]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 60586226) has the molecular formula C17H14F3N3O5S and a molecular weight of 429.38 g/mol. Its IUPAC name is 2-[[2-[4-nitro-2-(trifluoromethyl)phenoxy]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-nitro-2-(trifluoromethyl)phenoxy]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60586226 |
| Molecular Formula | C17H14F3N3O5S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[[2-[4-nitro-2-(trifluoromethyl)phenoxy]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)COc2ccc([N+](=O)[O-])cc2C(F)(F)F)sc2c1CCC2 |
| InChI | InChI=1S/C17H14F3N3O5S/c18-17(19,20)10-6-8(23(26)27)4-5-11(10)28-7-13(24)22-16-14(15(21)25)9-2-1-3-12(9)29-16/h4-6H,1-3,7H2,(H2,21,25)(H,22,24) |
| InChIKey | LZBWJFVAINBXCR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|