C21H31NO4S — CID 60586923
2-cyclopentylsulfonyl-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]acetamide (PubChem CID 60586923) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]acetamide.
| Compound Name | 2-cyclopentylsulfonyl-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 60586923 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-cyclopentylsulfonyl-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]acetamide |
| SMILES | COc1ccc(C2(CNC(=O)CS(=O)(=O)C3CCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C21H31NO4S/c1-26-18-11-9-17(10-12-18)21(13-5-2-6-14-21)16-22-20(23)15-27(24,25)19-7-3-4-8-19/h9-12,19H,2-8,13-16H2,1H3,(H,22,23) |
| InChIKey | NSMMJZDRANSRKS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |