C18H19BrN2O3S — CID 60586938
N-[2-[2-(4-bromophenyl)morpholin-4-yl]-2-oxoethyl]-N-methylthiophene-2-carboxamide (PubChem CID 60586938) has the molecular formula C18H19BrN2O3S and a molecular weight of 423.33 g/mol. Its IUPAC name is N-[2-[2-(4-bromophenyl)morpholin-4-yl]-2-oxoethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[2-(4-bromophenyl)morpholin-4-yl]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60586938 |
| Molecular Formula | C18H19BrN2O3S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[2-[2-(4-bromophenyl)morpholin-4-yl]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(CC(=O)N1CCOC(c2ccc(Br)cc2)C1)C(=O)c1cccs1 |
| InChI | InChI=1S/C18H19BrN2O3S/c1-20(18(23)16-3-2-10-25-16)12-17(22)21-8-9-24-15(11-21)13-4-6-14(19)7-5-13/h2-7,10,15H,8-9,11-12H2,1H3 |
| InChIKey | OWXUHUKDQVWLQU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |