About 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one
3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 605878) has the molecular formula C10H9FN2O
and a molecular weight of 192.19 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 605878 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2ccc(F)cc2)=NN1 |
| InChI | InChI=1S/C10H9FN2O/c11-8-3-1-7(2-4-8)9-5-6-10(14)13-12-9/h1-4H,5-6H2,(H,13,14) |
| InChIKey | CKONBUGAZNEEMK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one (CID 605878) is 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one is O=C1CCC(c2ccc(F)cc2)=NN1.
What is the InChIKey of 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is CKONBUGAZNEEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O/c11-8-3-1-7(2-4-8)9-5-6-10(14)13-12-9/h1-4H,5-6H2,(H,13,14).
What are the key properties of 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one?
3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 192.19 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 605878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).