About 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine
4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine (PubChem CID 60588487) has the molecular formula C8H13N3OS2
and a molecular weight of 231.35 g/mol. Its IUPAC name is 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
| PubChem CID | 60588487 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
| SMILES | CCSc1nnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C8H13N3OS2/c1-2-13-8-10-9-7(14-8)11-3-5-12-6-4-11/h2-6H2,1H3 |
| InChIKey | WDDSLPNELINGEP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The IUPAC name of 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine (CID 60588487) is 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine.
What is the SMILES notation for 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The canonical SMILES for 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine is CCSc1nnc(N2CCOCC2)s1.
What is the InChIKey of 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The InChIKey is WDDSLPNELINGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS2/c1-2-13-8-10-9-7(14-8)11-3-5-12-6-4-11/h2-6H2,1H3.
What are the key properties of 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine has a molecular weight of 231.35 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine is sourced from PubChem (CID 60588487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).